C17H10BrClO4 — CID 90170031
(3-chlorophenyl) 6-(bromomethyl)-2-oxochromene-3-carboxylate (PubChem CID 90170031) has the molecular formula C17H10BrClO4 and a molecular weight of 393.62 g/mol. Its IUPAC name is (3-chlorophenyl) 6-(bromomethyl)-2-oxochromene-3-carboxylate.
| Compound Name | (3-chlorophenyl) 6-(bromomethyl)-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 90170031 |
| Molecular Formula | C17H10BrClO4 |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | (3-chlorophenyl) 6-(bromomethyl)-2-oxochromene-3-carboxylate |
| SMILES | O=C(Oc1cccc(Cl)c1)c1cc2cc(CBr)ccc2oc1=O |
| InChI | InChI=1S/C17H10BrClO4/c18-9-10-4-5-15-11(6-10)7-14(17(21)23-15)16(20)22-13-3-1-2-12(19)8-13/h1-8H,9H2 |
| InChIKey | RNWNTBMGGUARMR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|