C24H30ClN3O4 — CID 170567465
[4-[2-(diaminomethylideneamino)ethyl]phenyl] 6-(chloromethyl)-2-oxochromene-3-carboxylate;ethane (PubChem CID 170567465) has the molecular formula C24H30ClN3O4 and a molecular weight of 459.97 g/mol. Its IUPAC name is [4-[2-(diaminomethylideneamino)ethyl]phenyl] 6-(chloromethyl)-2-oxochromene-3-carboxylate;ethane.
| Compound Name | [4-[2-(diaminomethylideneamino)ethyl]phenyl] 6-(chloromethyl)-2-oxochromene-3-carboxylate;ethane |
|---|---|
| PubChem CID | 170567465 |
| Molecular Formula | C24H30ClN3O4 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | [4-[2-(diaminomethylideneamino)ethyl]phenyl] 6-(chloromethyl)-2-oxochromene-3-carboxylate;ethane |
| SMILES | CC.CC.NC(N)=NCCc1ccc(OC(=O)c2cc3cc(CCl)ccc3oc2=O)cc1 |
| InChI | InChI=1S/C20H18ClN3O4.2C2H6/c21-11-13-3-6-17-14(9-13)10-16(19(26)28-17)18(25)27-15-4-1-12(2-5-15)7-8-24-20(22)23;2*1-2/h1-6,9-10H,7-8,11H2,(H4,22,23,24);2*1-2H3 |
| InChIKey | OXSVKEYTDPQUEQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|