C20H16NO5- — CID 163670495
[3-[4-(1-methoxyethenyl)phenoxy]carbonyl-2-oxochromen-6-yl]methylazanide (PubChem CID 163670495) has the molecular formula C20H16NO5- and a molecular weight of 350.35 g/mol. Its IUPAC name is [3-[4-(1-methoxyethenyl)phenoxy]carbonyl-2-oxochromen-6-yl]methylazanide.
| Compound Name | [3-[4-(1-methoxyethenyl)phenoxy]carbonyl-2-oxochromen-6-yl]methylazanide |
|---|---|
| PubChem CID | 163670495 |
| Molecular Formula | C20H16NO5- |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | [3-[4-(1-methoxyethenyl)phenoxy]carbonyl-2-oxochromen-6-yl]methylazanide |
| SMILES | C=C(OC)c1ccc(OC(=O)c2cc3cc(C[NH-])ccc3oc2=O)cc1 |
| InChI | InChI=1S/C20H16NO5/c1-12(24-2)14-4-6-16(7-5-14)25-19(22)17-10-15-9-13(11-21)3-8-18(15)26-20(17)23/h3-10,21H,1,11H2,2H3/q-1 |
| InChIKey | JCCPMEPSIXWTGI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 89.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|