C26H27NO8 — CID 170319662
[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate (PubChem CID 170319662) has the molecular formula C26H27NO8 and a molecular weight of 481.50 g/mol. Its IUPAC name is [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate.
| Compound Name | [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 170319662 |
| Molecular Formula | C26H27NO8 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate |
| SMILES | CC(=O)OCc1ccc2oc(=O)c(C(=O)Oc3ccc(CCNC(=O)OC(C)(C)C)cc3)cc2c1 |
| InChI | InChI=1S/C26H27NO8/c1-16(28)32-15-18-7-10-22-19(13-18)14-21(24(30)34-22)23(29)33-20-8-5-17(6-9-20)11-12-27-25(31)35-26(2,3)4/h5-10,13-14H,11-12,15H2,1-4H3,(H,27,31) |
| InChIKey | LUSOGXYJSRLICU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|