C31H38ClN3O8 — CID 170567471
tert-butyl formate;[4-[2-[[N'-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]ethyl]phenyl] 6-(chloromethyl)-2-oxochromene-3-carboxylate (PubChem CID 170567471) has the molecular formula C31H38ClN3O8 and a molecular weight of 616.11 g/mol. Its IUPAC name is tert-butyl formate;[4-[2-[[N'-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]ethyl]phenyl] 6-(chloromethyl)-2-oxochromene-3-carboxylate.
| Compound Name | tert-butyl formate;[4-[2-[[N'-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]ethyl]phenyl] 6-(chloromethyl)-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 170567471 |
| Molecular Formula | C31H38ClN3O8 |
| Molecular Weight | 616.11 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | tert-butyl formate;[4-[2-[[N'-methyl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]amino]ethyl]phenyl] 6-(chloromethyl)-2-oxochromene-3-carboxylate |
| SMILES | C/N=C(/NCCc1ccc(OC(=O)c2cc3cc(CCl)ccc3oc2=O)cc1)NC(=O)OC(C)(C)C.CC(C)(C)OC=O |
| InChI | InChI=1S/C26H28ClN3O6.C5H10O2/c1-26(2,3)36-25(33)30-24(28-4)29-12-11-16-5-8-19(9-6-16)34-22(31)20-14-18-13-17(15-27)7-10-21(18)35-23(20)32;1-5(2,3)7-4-6/h5-10,13-14H,11-12,15H2,1-4H3,(H2,28,29,30,33);4H,1-3H3 |
| InChIKey | LFSIKBAZUBVZFK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.11 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|