C24H25N3O6 — CID 170567445
[4-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]phenyl] 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate (PubChem CID 170567445) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is [4-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]phenyl] 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate.
| Compound Name | [4-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]phenyl] 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 170567445 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | [4-[2-[(N,N'-dimethylcarbamimidoyl)amino]ethyl]phenyl] 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate |
| SMILES | C/N=C(\NC)NCCc1ccc(OC(=O)c2cc3cc(COC(C)=O)ccc3oc2=O)cc1 |
| InChI | InChI=1S/C24H25N3O6/c1-15(28)31-14-17-6-9-21-18(12-17)13-20(23(30)33-21)22(29)32-19-7-4-16(5-8-19)10-11-27-24(25-2)26-3/h4-9,12-13H,10-11,14H2,1-3H3,(H2,25,26,27) |
| InChIKey | HXTVWBMCIDUSRY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|