About (5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate
(5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate (PubChem CID 144511532) has the molecular formula C19H15ClO6
and a molecular weight of 374.78 g/mol. Its IUPAC name is (5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate.
Molecular Properties
| Compound Name | (5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate |
| PubChem CID | 144511532 |
| Molecular Formula | C19H15ClO6 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate |
| SMILES | CC(=O)OCc1ccc2oc(=O)c(C(=O)OC3=CCCC(Cl)=C3)cc2c1 |
| InChI | InChI=1S/C19H15ClO6/c1-11(21)24-10-12-5-6-17-13(7-12)8-16(19(23)26-17)18(22)25-15-4-2-3-14(20)9-15/h4-9H,2-3,10H2,1H3 |
| InChIKey | RBJKBNAANIBVGK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze (5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate?
The IUPAC name of (5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate (CID 144511532) is (5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate.
What is the SMILES notation for (5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate?
The canonical SMILES for (5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate is CC(=O)OCc1ccc2oc(=O)c(C(=O)OC3=CCCC(Cl)=C3)cc2c1.
What is the InChIKey of (5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate?
The InChIKey is RBJKBNAANIBVGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClO6/c1-11(21)24-10-12-5-6-17-13(7-12)8-16(19(23)26-17)18(22)25-15-4-2-3-14(20)9-15/h4-9H,2-3,10H2,1H3.
What are the key properties of (5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate?
(5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate has a molecular weight of 374.78 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chlorocyclohexa-1,5-dien-1-yl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate is sourced from PubChem (CID 144511532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).