C19H13FO6 — CID 71502784
(3-fluorophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate (PubChem CID 71502784) has the molecular formula C19H13FO6 and a molecular weight of 356.31 g/mol. Its IUPAC name is (3-fluorophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate.
| Compound Name | (3-fluorophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 71502784 |
| Molecular Formula | C19H13FO6 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (3-fluorophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate |
| SMILES | CC(=O)OCc1ccc2oc(=O)c(C(=O)Oc3cccc(F)c3)cc2c1 |
| InChI | InChI=1S/C19H13FO6/c1-11(21)24-10-12-5-6-17-13(7-12)8-16(19(23)26-17)18(22)25-15-4-2-3-14(20)9-15/h2-9H,10H2,1H3 |
| InChIKey | OOFHZAJXZVHWMK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|