About (3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride
(3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride (PubChem CID 25189281) has the molecular formula C17H13ClINO4
and a molecular weight of 457.65 g/mol. Its IUPAC name is (3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | (3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride |
| PubChem CID | 25189281 |
| Molecular Formula | C17H13ClINO4 |
| Molecular Weight | 457.65 g/mol |
| Exact Mass | 456.96 |
| IUPAC Name | (3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride |
| SMILES | Cl.NCc1ccc2oc(=O)c(C(=O)Oc3cccc(I)c3)cc2c1 |
| InChI | InChI=1S/C17H12INO4.ClH/c18-12-2-1-3-13(8-12)22-16(20)14-7-11-6-10(9-19)4-5-15(11)23-17(14)21;/h1-8H,9,19H2;1H |
| InChIKey | JHKRUQRCNZLPNO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.65 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride?
The IUPAC name of (3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride (CID 25189281) is (3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride.
What is the SMILES notation for (3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride?
The canonical SMILES for (3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride is Cl.NCc1ccc2oc(=O)c(C(=O)Oc3cccc(I)c3)cc2c1.
What is the InChIKey of (3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride?
The InChIKey is JHKRUQRCNZLPNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12INO4.ClH/c18-12-2-1-3-13(8-12)22-16(20)14-7-11-6-10(9-19)4-5-15(11)23-17(14)21;/h1-8H,9,19H2;1H.
What are the key properties of (3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride?
(3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride has a molecular weight of 457.65 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-iodophenyl) 6-(aminomethyl)-2-oxochromene-3-carboxylate;hydrochloride is sourced from PubChem (CID 25189281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).