About (2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate
(2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate (PubChem CID 86720174) has the molecular formula C20H13NO6
and a molecular weight of 363.33 g/mol. Its IUPAC name is (2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate.
Molecular Properties
| Compound Name | (2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate |
| PubChem CID | 86720174 |
| Molecular Formula | C20H13NO6 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | (2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate |
| SMILES | CC(=O)OCc1ccc2oc(=O)c(C(=O)Oc3ccccc3C#N)cc2c1 |
| InChI | InChI=1S/C20H13NO6/c1-12(22)25-11-13-6-7-18-15(8-13)9-16(20(24)27-18)19(23)26-17-5-3-2-4-14(17)10-21/h2-9H,11H2,1H3 |
| InChIKey | VYQRLCPMERGGPA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 106.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate?
The IUPAC name of (2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate (CID 86720174) is (2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate.
What is the SMILES notation for (2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate?
The canonical SMILES for (2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate is CC(=O)OCc1ccc2oc(=O)c(C(=O)Oc3ccccc3C#N)cc2c1.
What is the InChIKey of (2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate?
The InChIKey is VYQRLCPMERGGPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13NO6/c1-12(22)25-11-13-6-7-18-15(8-13)9-16(20(24)27-18)19(23)26-17-5-3-2-4-14(17)10-21/h2-9H,11H2,1H3.
What are the key properties of (2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate?
(2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate has a molecular weight of 363.33 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanophenyl) 6-(acetyloxymethyl)-2-oxochromene-3-carboxylate is sourced from PubChem (CID 86720174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).