About (5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate
(5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate (PubChem CID 10829157) has the molecular formula C16H10ClNO4
and a molecular weight of 315.71 g/mol. Its IUPAC name is (5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate.
Molecular Properties
| Compound Name | (5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate |
| PubChem CID | 10829157 |
| Molecular Formula | C16H10ClNO4 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | (5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate |
| SMILES | Cc1ccc2oc(=O)c(C(=O)Oc3cncc(Cl)c3)cc2c1 |
| InChI | InChI=1S/C16H10ClNO4/c1-9-2-3-14-10(4-9)5-13(16(20)22-14)15(19)21-12-6-11(17)7-18-8-12/h2-8H,1H3 |
| InChIKey | ZDUPBYOSVQOEEO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate?
The IUPAC name of (5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate (CID 10829157) is (5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate.
What is the SMILES notation for (5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate?
The canonical SMILES for (5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate is Cc1ccc2oc(=O)c(C(=O)Oc3cncc(Cl)c3)cc2c1.
What is the InChIKey of (5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate?
The InChIKey is ZDUPBYOSVQOEEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClNO4/c1-9-2-3-14-10(4-9)5-13(16(20)22-14)15(19)21-12-6-11(17)7-18-8-12/h2-8H,1H3.
What are the key properties of (5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate?
(5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate has a molecular weight of 315.71 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-3-pyridinyl) 6-methyl-2-oxochromene-3-carboxylate is sourced from PubChem (CID 10829157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).