C20H24N2O4 — CID 19133552
N-(4-acetylphenyl)-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide (PubChem CID 19133552) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is N-(4-acetylphenyl)-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-(4-acetylphenyl)-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 19133552 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-(4-acetylphenyl)-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)C2CC=CCC2C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-14(23)15-6-8-16(9-7-15)21-19(24)17-4-2-3-5-18(17)20(25)22-10-12-26-13-11-22/h2-3,6-9,17-18H,4-5,10-13H2,1H3,(H,21,24) |
| InChIKey | MLSUJHBDRHHZGO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|