C18H23N3O3 — CID 124621745
(1S,6R)-N-(2-methyl-4-pyridinyl)-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide (PubChem CID 124621745) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (1S,6R)-N-(2-methyl-4-pyridinyl)-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S,6R)-N-(2-methyl-4-pyridinyl)-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 124621745 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (1S,6R)-N-(2-methyl-4-pyridinyl)-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide |
| SMILES | Cc1cc(NC(=O)[C@H]2CC=CC[C@H]2C(=O)N2CCOCC2)ccn1 |
| InChI | InChI=1S/C18H23N3O3/c1-13-12-14(6-7-19-13)20-17(22)15-4-2-3-5-16(15)18(23)21-8-10-24-11-9-21/h2-3,6-7,12,15-16H,4-5,8-11H2,1H3,(H,19,20,22)/t15-,16+/m0/s1 |
| InChIKey | YNRHMYNEMBLGAK-JKSUJKDBSA-N |
| XLogP | 1.77 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|