C27H26FN3O4 — CID 167937054
N-[4-fluoro-3-(1H-indole-3-carbonyl)phenyl]-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide (PubChem CID 167937054) has the molecular formula C27H26FN3O4 and a molecular weight of 475.52 g/mol. Its IUPAC name is N-[4-fluoro-3-(1H-indole-3-carbonyl)phenyl]-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[4-fluoro-3-(1H-indole-3-carbonyl)phenyl]-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 167937054 |
| Molecular Formula | C27H26FN3O4 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-[4-fluoro-3-(1H-indole-3-carbonyl)phenyl]-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(c1cc(NC(=O)C2CC=CCC2C(=O)N2CCOCC2)ccc1F)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H26FN3O4/c28-23-10-9-17(15-21(23)25(32)22-16-29-24-8-4-3-5-18(22)24)30-26(33)19-6-1-2-7-20(19)27(34)31-11-13-35-14-12-31/h1-5,8-10,15-16,19-20,29H,6-7,11-14H2,(H,30,33) |
| InChIKey | ICFSYJAQIBUUOK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|