C34H31ClN2O4 — CID 19134122
13-[3-[(4-chlorophenyl)methoxy]phenyl]-14-[2-(diethylamino)ethyl]-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione (PubChem CID 19134122) has the molecular formula C34H31ClN2O4 and a molecular weight of 567.09 g/mol. Its IUPAC name is 13-[3-[(4-chlorophenyl)methoxy]phenyl]-14-[2-(diethylamino)ethyl]-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione.
| Compound Name | 13-[3-[(4-chlorophenyl)methoxy]phenyl]-14-[2-(diethylamino)ethyl]-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
|---|---|
| PubChem CID | 19134122 |
| Molecular Formula | C34H31ClN2O4 |
| Molecular Weight | 567.09 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 13-[3-[(4-chlorophenyl)methoxy]phenyl]-14-[2-(diethylamino)ethyl]-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
| SMILES | CCN(CC)CCN1C(=O)c2oc3c(ccc4ccccc43)c(=O)c2C1c1cccc(OCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C34H31ClN2O4/c1-3-36(4-2)18-19-37-30(24-9-7-10-26(20-24)40-21-22-12-15-25(35)16-13-22)29-31(38)28-17-14-23-8-5-6-11-27(23)32(28)41-33(29)34(37)39/h5-17,20,30H,3-4,18-19,21H2,1-2H3 |
| InChIKey | LRZSHFKLUJMUOH-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.09 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|