C28H27FN2O3 — CID 19134210
14-[3-(diethylamino)propyl]-13-(3-fluorophenyl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione (PubChem CID 19134210) has the molecular formula C28H27FN2O3 and a molecular weight of 458.53 g/mol. Its IUPAC name is 14-[3-(diethylamino)propyl]-13-(3-fluorophenyl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione.
| Compound Name | 14-[3-(diethylamino)propyl]-13-(3-fluorophenyl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
|---|---|
| PubChem CID | 19134210 |
| Molecular Formula | C28H27FN2O3 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 14-[3-(diethylamino)propyl]-13-(3-fluorophenyl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
| SMILES | CCN(CC)CCCN1C(=O)c2oc3c(ccc4ccccc43)c(=O)c2C1c1cccc(F)c1 |
| InChI | InChI=1S/C28H27FN2O3/c1-3-30(4-2)15-8-16-31-24(19-10-7-11-20(29)17-19)23-25(32)22-14-13-18-9-5-6-12-21(18)26(22)34-27(23)28(31)33/h5-7,9-14,17,24H,3-4,8,15-16H2,1-2H3 |
| InChIKey | BDBLDLPWTLRUNN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|