C26H23FN2O3 — CID 4897777
14-[3-(dimethylamino)propyl]-13-(4-fluorophenyl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione (PubChem CID 4897777) has the molecular formula C26H23FN2O3 and a molecular weight of 430.48 g/mol. Its IUPAC name is 14-[3-(dimethylamino)propyl]-13-(4-fluorophenyl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione.
| Compound Name | 14-[3-(dimethylamino)propyl]-13-(4-fluorophenyl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
|---|---|
| PubChem CID | 4897777 |
| Molecular Formula | C26H23FN2O3 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 14-[3-(dimethylamino)propyl]-13-(4-fluorophenyl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
| SMILES | CN(C)CCCN1C(=O)c2oc3c(ccc4ccccc43)c(=O)c2C1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H23FN2O3/c1-28(2)14-5-15-29-22(17-8-11-18(27)12-9-17)21-23(30)20-13-10-16-6-3-4-7-19(16)24(20)32-25(21)26(29)31/h3-4,6-13,22H,5,14-15H2,1-2H3 |
| InChIKey | OFFVRTYHWBTCJB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|