C33H29ClN2O4 — CID 19134060
13-[4-[(2-chlorophenyl)methoxy]phenyl]-14-[3-(dimethylamino)propyl]-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione (PubChem CID 19134060) has the molecular formula C33H29ClN2O4 and a molecular weight of 553.06 g/mol. Its IUPAC name is 13-[4-[(2-chlorophenyl)methoxy]phenyl]-14-[3-(dimethylamino)propyl]-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione.
| Compound Name | 13-[4-[(2-chlorophenyl)methoxy]phenyl]-14-[3-(dimethylamino)propyl]-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
|---|---|
| PubChem CID | 19134060 |
| Molecular Formula | C33H29ClN2O4 |
| Molecular Weight | 553.06 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 13-[4-[(2-chlorophenyl)methoxy]phenyl]-14-[3-(dimethylamino)propyl]-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
| SMILES | CN(C)CCCN1C(=O)c2oc3c(ccc4ccccc43)c(=O)c2C1c1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C33H29ClN2O4/c1-35(2)18-7-19-36-29(22-12-15-24(16-13-22)39-20-23-9-4-6-11-27(23)34)28-30(37)26-17-14-21-8-3-5-10-25(21)31(26)40-32(28)33(36)38/h3-6,8-17,29H,7,18-20H2,1-2H3 |
| InChIKey | HZBMCCKVNBBAAE-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.06 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|