C21H19ClN2O4 — CID 19134606
7-chloro-2-(3-methoxypropyl)-6-methyl-1-pyridin-2-yl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19134606) has the molecular formula C21H19ClN2O4 and a molecular weight of 398.85 g/mol. Its IUPAC name is 7-chloro-2-(3-methoxypropyl)-6-methyl-1-pyridin-2-yl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-(3-methoxypropyl)-6-methyl-1-pyridin-2-yl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19134606 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 7-chloro-2-(3-methoxypropyl)-6-methyl-1-pyridin-2-yl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COCCCN1C(=O)c2oc3cc(C)c(Cl)cc3c(=O)c2C1c1ccccn1 |
| InChI | InChI=1S/C21H19ClN2O4/c1-12-10-16-13(11-14(12)22)19(25)17-18(15-6-3-4-7-23-15)24(8-5-9-27-2)21(26)20(17)28-16/h3-4,6-7,10-11,18H,5,8-9H2,1-2H3 |
| InChIKey | TYPKJNGDEBTYTI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|