C22H22N2O4 — CID 23473063
7-ethyl-2-(3-methoxypropyl)-1-pyridin-2-yl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 23473063) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 7-ethyl-2-(3-methoxypropyl)-1-pyridin-2-yl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-ethyl-2-(3-methoxypropyl)-1-pyridin-2-yl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 23473063 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 7-ethyl-2-(3-methoxypropyl)-1-pyridin-2-yl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCc1ccc2oc3c(c(=O)c2c1)C(c1ccccn1)N(CCCOC)C3=O |
| InChI | InChI=1S/C22H22N2O4/c1-3-14-8-9-17-15(13-14)20(25)18-19(16-7-4-5-10-23-16)24(11-6-12-27-2)22(26)21(18)28-17/h4-5,7-10,13,19H,3,6,11-12H2,1-2H3 |
| InChIKey | XELGLEXHNMGIJA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|