About 4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine
4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine (PubChem CID 19138753) has the molecular formula C22H24N4O
and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine.
Molecular Properties
| Compound Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine |
| PubChem CID | 19138753 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine |
| SMILES | CC(C)c1ccc(Oc2ncnc(N3CCCc4ccccc43)c2N)cc1 |
| InChI | InChI=1S/C22H24N4O/c1-15(2)16-9-11-18(12-10-16)27-22-20(23)21(24-14-25-22)26-13-5-7-17-6-3-4-8-19(17)26/h3-4,6,8-12,14-15H,5,7,13,23H2,1-2H3 |
| InChIKey | DTTQBTDGKNOJFR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine?
The IUPAC name of 4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine (CID 19138753) is 4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine.
What is the SMILES notation for 4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine?
The canonical SMILES for 4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine is CC(C)c1ccc(Oc2ncnc(N3CCCc4ccccc43)c2N)cc1.
What is the InChIKey of 4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine?
The InChIKey is DTTQBTDGKNOJFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O/c1-15(2)16-9-11-18(12-10-16)27-22-20(23)21(24-14-25-22)26-13-5-7-17-6-3-4-8-19(17)26/h3-4,6,8-12,14-15H,5,7,13,23H2,1-2H3.
What are the key properties of 4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine?
4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine has a molecular weight of 360.46 g/mol, XLogP of 5.06, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydro-2H-quinolin-1-yl)-6-(4-propan-2-ylphenoxy)pyrimidin-5-amine is sourced from PubChem (CID 19138753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).