C15H16ClN3 — CID 63735943
1-(6-chloro-5-ethylpyrimidin-4-yl)-3,4-dihydro-2H-quinoline (PubChem CID 63735943) has the molecular formula C15H16ClN3 and a molecular weight of 273.77 g/mol. Its IUPAC name is 1-(6-chloro-5-ethylpyrimidin-4-yl)-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(6-chloro-5-ethylpyrimidin-4-yl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 63735943 |
| Molecular Formula | C15H16ClN3 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 1-(6-chloro-5-ethylpyrimidin-4-yl)-3,4-dihydro-2H-quinoline |
| SMILES | CCc1c(Cl)ncnc1N1CCCc2ccccc21 |
| InChI | InChI=1S/C15H16ClN3/c1-2-12-14(16)17-10-18-15(12)19-9-5-7-11-6-3-4-8-13(11)19/h3-4,6,8,10H,2,5,7,9H2,1H3 |
| InChIKey | JTNNSUHAIHKJBP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |