C21H20N6 — CID 19143217
6-N-(2,3-dimethylphenyl)-4-N-quinolin-5-ylpyrimidine-4,5,6-triamine (PubChem CID 19143217) has the molecular formula C21H20N6 and a molecular weight of 356.43 g/mol. Its IUPAC name is 6-N-(2,3-dimethylphenyl)-4-N-quinolin-5-ylpyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(2,3-dimethylphenyl)-4-N-quinolin-5-ylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19143217 |
| Molecular Formula | C21H20N6 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 6-N-(2,3-dimethylphenyl)-4-N-quinolin-5-ylpyrimidine-4,5,6-triamine |
| SMILES | Cc1cccc(Nc2ncnc(Nc3cccc4ncccc34)c2N)c1C |
| InChI | InChI=1S/C21H20N6/c1-13-6-3-8-16(14(13)2)26-20-19(22)21(25-12-24-20)27-18-10-4-9-17-15(18)7-5-11-23-17/h3-12H,22H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | SBLIUDNXBMFKPL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |