C19H14Cl2N6 — CID 22545033
4-N-(3,5-dichlorophenyl)-6-N-quinolin-5-ylpyrimidine-4,5,6-triamine (PubChem CID 22545033) has the molecular formula C19H14Cl2N6 and a molecular weight of 397.27 g/mol. Its IUPAC name is 4-N-(3,5-dichlorophenyl)-6-N-quinolin-5-ylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(3,5-dichlorophenyl)-6-N-quinolin-5-ylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22545033 |
| Molecular Formula | C19H14Cl2N6 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 4-N-(3,5-dichlorophenyl)-6-N-quinolin-5-ylpyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2cc(Cl)cc(Cl)c2)ncnc1Nc1cccc2ncccc12 |
| InChI | InChI=1S/C19H14Cl2N6/c20-11-7-12(21)9-13(8-11)26-18-17(22)19(25-10-24-18)27-16-5-1-4-15-14(16)3-2-6-23-15/h1-10H,22H2,(H2,24,25,26,27) |
| InChIKey | MTVGKPDKZBJKKK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |