C17H15BrN4O — CID 19144569
6-(4-bromophenoxy)-4-N-methyl-4-N-phenylpyrimidine-4,5-diamine (PubChem CID 19144569) has the molecular formula C17H15BrN4O and a molecular weight of 371.24 g/mol. Its IUPAC name is 6-(4-bromophenoxy)-4-N-methyl-4-N-phenylpyrimidine-4,5-diamine.
| Compound Name | 6-(4-bromophenoxy)-4-N-methyl-4-N-phenylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19144569 |
| Molecular Formula | C17H15BrN4O |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 6-(4-bromophenoxy)-4-N-methyl-4-N-phenylpyrimidine-4,5-diamine |
| SMILES | CN(c1ccccc1)c1ncnc(Oc2ccc(Br)cc2)c1N |
| InChI | InChI=1S/C17H15BrN4O/c1-22(13-5-3-2-4-6-13)16-15(19)17(21-11-20-16)23-14-9-7-12(18)8-10-14/h2-11H,19H2,1H3 |
| InChIKey | CUDWMQONLRBCGI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |