C20H22N4O — CID 22539683
4-N-benzyl-6-(4-ethylphenoxy)-4-N-methylpyrimidine-4,5-diamine (PubChem CID 22539683) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-N-benzyl-6-(4-ethylphenoxy)-4-N-methylpyrimidine-4,5-diamine.
| Compound Name | 4-N-benzyl-6-(4-ethylphenoxy)-4-N-methylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22539683 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 4-N-benzyl-6-(4-ethylphenoxy)-4-N-methylpyrimidine-4,5-diamine |
| SMILES | CCc1ccc(Oc2ncnc(N(C)Cc3ccccc3)c2N)cc1 |
| InChI | InChI=1S/C20H22N4O/c1-3-15-9-11-17(12-10-15)25-20-18(21)19(22-14-23-20)24(2)13-16-7-5-4-6-8-16/h4-12,14H,3,13,21H2,1-2H3 |
| InChIKey | OJNNCMJVKPXPPD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |