C22H19N5S — CID 19149747
4-N-benzyl-6-phenylsulfanyl-4-N-pyridin-2-ylpyrimidine-4,5-diamine (PubChem CID 19149747) has the molecular formula C22H19N5S and a molecular weight of 385.50 g/mol. Its IUPAC name is 4-N-benzyl-6-phenylsulfanyl-4-N-pyridin-2-ylpyrimidine-4,5-diamine.
| Compound Name | 4-N-benzyl-6-phenylsulfanyl-4-N-pyridin-2-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19149747 |
| Molecular Formula | C22H19N5S |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 4-N-benzyl-6-phenylsulfanyl-4-N-pyridin-2-ylpyrimidine-4,5-diamine |
| SMILES | Nc1c(Sc2ccccc2)ncnc1N(Cc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C22H19N5S/c23-20-21(25-16-26-22(20)28-18-11-5-2-6-12-18)27(19-13-7-8-14-24-19)15-17-9-3-1-4-10-17/h1-14,16H,15,23H2 |
| InChIKey | HXIHSTMIKJABNY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |