C25H32N4O3 — CID 19155394
(4E)-N,3-dimethyl-4-[(3-methylbenzoyl)hydrazinylidene]-N-(1-methylpiperidin-4-yl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide (PubChem CID 19155394) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is (4E)-N,3-dimethyl-4-[(3-methylbenzoyl)hydrazinylidene]-N-(1-methylpiperidin-4-yl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide.
| Compound Name | (4E)-N,3-dimethyl-4-[(3-methylbenzoyl)hydrazinylidene]-N-(1-methylpiperidin-4-yl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19155394 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | (4E)-N,3-dimethyl-4-[(3-methylbenzoyl)hydrazinylidene]-N-(1-methylpiperidin-4-yl)-6,7-dihydro-5H-1-benzofuran-2-carboxamide |
| SMILES | Cc1cccc(C(=O)N/N=C2\CCCc3oc(C(=O)N(C)C4CCN(C)CC4)c(C)c32)c1 |
| InChI | InChI=1S/C25H32N4O3/c1-16-7-5-8-18(15-16)24(30)27-26-20-9-6-10-21-22(20)17(2)23(32-21)25(31)29(4)19-11-13-28(3)14-12-19/h5,7-8,15,19H,6,9-14H2,1-4H3,(H,27,30)/b26-20+ |
| InChIKey | REAACYGOBVSVPG-LHLOQNFPSA-N |
| XLogP | 3.53 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|