C24H24N4O3 — CID 19155458
N-[(E)-[2-(anilinocarbamoyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-3-methylbenzamide (PubChem CID 19155458) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[(E)-[2-(anilinocarbamoyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-3-methylbenzamide.
| Compound Name | N-[(E)-[2-(anilinocarbamoyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-3-methylbenzamide |
|---|---|
| PubChem CID | 19155458 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[(E)-[2-(anilinocarbamoyl)-3-methyl-6,7-dihydro-5H-1-benzofuran-4-ylidene]amino]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N/N=C2\CCCc3oc(C(=O)NNc4ccccc4)c(C)c32)c1 |
| InChI | InChI=1S/C24H24N4O3/c1-15-8-6-9-17(14-15)23(29)27-26-19-12-7-13-20-21(19)16(2)22(31-20)24(30)28-25-18-10-4-3-5-11-18/h3-6,8-11,14,25H,7,12-13H2,1-2H3,(H,27,29)(H,28,30)/b26-19+ |
| InChIKey | BIWYSDOTWTYYRA-LGUFXXKBSA-N |
| XLogP | 4.12 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|