C17H13ClKN3O6 — CID 19157698
potassium (4E)-4-[(4-chloro-3-nitrobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 19157698) has the molecular formula C17H13ClKN3O6 and a molecular weight of 429.86 g/mol. Its IUPAC name is potassium (4E)-4-[(4-chloro-3-nitrobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | potassium (4E)-4-[(4-chloro-3-nitrobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19157698 |
| Molecular Formula | C17H13ClKN3O6 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | potassium (4E)-4-[(4-chloro-3-nitrobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)[O-])oc2c1/C(=N/NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)CCC2.[K+] |
| InChI | InChI=1S/C17H14ClN3O6.K/c1-8-14-11(3-2-4-13(14)27-15(8)17(23)24)19-20-16(22)9-5-6-10(18)12(7-9)21(25)26;/h5-7H,2-4H2,1H3,(H,20,22)(H,23,24);/q;+1/p-1/b19-11+; |
| InChIKey | SCZPHMNOPZMTOZ-YLFUTEQJSA-M |
| XLogP | -1.01 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|