C17H14FKN2O4 — CID 23689191
potassium (4E)-4-[(4-fluorobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate (PubChem CID 23689191) has the molecular formula C17H14FKN2O4 and a molecular weight of 368.41 g/mol. Its IUPAC name is potassium (4E)-4-[(4-fluorobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate.
| Compound Name | potassium (4E)-4-[(4-fluorobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 23689191 |
| Molecular Formula | C17H14FKN2O4 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | potassium (4E)-4-[(4-fluorobenzoyl)hydrazinylidene]-3-methyl-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)[O-])oc2c1/C(=N/NC(=O)c1ccc(F)cc1)CCC2.[K+] |
| InChI | InChI=1S/C17H15FN2O4.K/c1-9-14-12(3-2-4-13(14)24-15(9)17(22)23)19-20-16(21)10-5-7-11(18)8-6-10;/h5-8H,2-4H2,1H3,(H,20,21)(H,22,23);/q;+1/p-1/b19-12+; |
| InChIKey | IBRGLWFLKKNQDK-NNTHFVATSA-M |
| XLogP | -1.43 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|