C17H18N4O4S — CID 19165385
ethyl 5-acetyl-4-methyl-2-[(pyridin-3-ylmethylideneamino)carbamoylamino]thiophene-3-carboxylate (PubChem CID 19165385) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is ethyl 5-acetyl-4-methyl-2-[(pyridin-3-ylmethylideneamino)carbamoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-4-methyl-2-[(pyridin-3-ylmethylideneamino)carbamoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19165385 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | ethyl 5-acetyl-4-methyl-2-[(pyridin-3-ylmethylideneamino)carbamoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)NN=Cc2cccnc2)sc(C(C)=O)c1C |
| InChI | InChI=1S/C17H18N4O4S/c1-4-25-16(23)13-10(2)14(11(3)22)26-15(13)20-17(24)21-19-9-12-6-5-7-18-8-12/h5-9H,4H2,1-3H3,(H2,20,21,24) |
| InChIKey | SBEFLPLVHVDVJY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|