C31H36O4 — CID 19171210
[2-methoxy-4-[(E)-2-phenylethenyl]phenyl] 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetate (PubChem CID 19171210) has the molecular formula C31H36O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-2-phenylethenyl]phenyl] 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetate.
| Compound Name | [2-methoxy-4-[(E)-2-phenylethenyl]phenyl] 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 19171210 |
| Molecular Formula | C31H36O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | [2-methoxy-4-[(E)-2-phenylethenyl]phenyl] 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetate |
| SMILES | COc1cc(/C=C/c2ccccc2)ccc1OC(=O)COc1ccc(C(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C31H36O4/c1-30(2,3)22-31(4,5)25-15-17-26(18-16-25)34-21-29(32)35-27-19-14-24(20-28(27)33-6)13-12-23-10-8-7-9-11-23/h7-20H,21-22H2,1-6H3/b13-12+ |
| InChIKey | BIFPGIHJQQVBHT-OUKQBFOZSA-N |
| XLogP | 7.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|