C23H27NO4 — CID 19172042
2-ethoxyethyl 3-[[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 19172042) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 2-ethoxyethyl 3-[[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | 2-ethoxyethyl 3-[[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 19172042 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-ethoxyethyl 3-[[(E)-3-(4-propan-2-ylphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | CCOCCOC(=O)c1cccc(NC(=O)/C=C/c2ccc(C(C)C)cc2)c1 |
| InChI | InChI=1S/C23H27NO4/c1-4-27-14-15-28-23(26)20-6-5-7-21(16-20)24-22(25)13-10-18-8-11-19(12-9-18)17(2)3/h5-13,16-17H,4,14-15H2,1-3H3,(H,24,25)/b13-10+ |
| InChIKey | AABDLJILTUPPQD-JLHYYAGUSA-N |
| XLogP | 4.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|