C20H21ClO3 — CID 19181707
(4-chloro-3,5-dimethylphenyl) (E)-3-(4-propoxyphenyl)prop-2-enoate (PubChem CID 19181707) has the molecular formula C20H21ClO3 and a molecular weight of 344.84 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) (E)-3-(4-propoxyphenyl)prop-2-enoate.
| Compound Name | (4-chloro-3,5-dimethylphenyl) (E)-3-(4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19181707 |
| Molecular Formula | C20H21ClO3 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) (E)-3-(4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1ccc(/C=C/C(=O)Oc2cc(C)c(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C20H21ClO3/c1-4-11-23-17-8-5-16(6-9-17)7-10-19(22)24-18-12-14(2)20(21)15(3)13-18/h5-10,12-13H,4,11H2,1-3H3/b10-7+ |
| InChIKey | BRUYJMKMMJTYPU-JXMROGBWSA-N |
| XLogP | 5.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|