C25H33NO4 — CID 19191715
N,N-dicyclohexyl-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide (PubChem CID 19191715) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide.
| Compound Name | N,N-dicyclohexyl-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide |
|---|---|
| PubChem CID | 19191715 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | N,N-dicyclohexyl-2-(4-methyl-2-oxochromen-7-yl)oxypropanamide |
| SMILES | Cc1cc(=O)oc2cc(OC(C)C(=O)N(C3CCCCC3)C3CCCCC3)ccc12 |
| InChI | InChI=1S/C25H33NO4/c1-17-15-24(27)30-23-16-21(13-14-22(17)23)29-18(2)25(28)26(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h13-16,18-20H,3-12H2,1-2H3 |
| InChIKey | DZKYPWSCHFXSKJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|