C12H17N5S — CID 19194699
3-pentylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-amine (PubChem CID 19194699) has the molecular formula C12H17N5S and a molecular weight of 263.37 g/mol. Its IUPAC name is 3-pentylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-amine.
| Compound Name | 3-pentylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 19194699 |
| Molecular Formula | C12H17N5S |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-pentylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-amine |
| SMILES | CCCCCSc1nnc(-c2ccncc2)n1N |
| InChI | InChI=1S/C12H17N5S/c1-2-3-4-9-18-12-16-15-11(17(12)13)10-5-7-14-8-6-10/h5-8H,2-4,9,13H2,1H3 |
| InChIKey | RFDJBBZFGUNTGQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|