C14H21N5S — CID 19194701
3-heptylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-amine (PubChem CID 19194701) has the molecular formula C14H21N5S and a molecular weight of 291.42 g/mol. Its IUPAC name is 3-heptylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-amine.
| Compound Name | 3-heptylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 19194701 |
| Molecular Formula | C14H21N5S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3-heptylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-amine |
| SMILES | CCCCCCCSc1nnc(-c2ccncc2)n1N |
| InChI | InChI=1S/C14H21N5S/c1-2-3-4-5-6-11-20-14-18-17-13(19(14)15)12-7-9-16-10-8-12/h7-10H,2-6,11,15H2,1H3 |
| InChIKey | DPUHYBLYJSQEMZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|