C27H28N2O4S2 — CID 19197813
methyl 2-[(5Z)-5-(1-heptyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate (PubChem CID 19197813) has the molecular formula C27H28N2O4S2 and a molecular weight of 508.67 g/mol. Its IUPAC name is methyl 2-[(5Z)-5-(1-heptyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate.
| Compound Name | methyl 2-[(5Z)-5-(1-heptyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 19197813 |
| Molecular Formula | C27H28N2O4S2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | methyl 2-[(5Z)-5-(1-heptyl-2-oxoindol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
| SMILES | CCCCCCCN1C(=O)/C(=C2\SC(=S)N(C(C(=O)OC)c3ccccc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C27H28N2O4S2/c1-3-4-5-6-12-17-28-20-16-11-10-15-19(20)21(24(28)30)23-25(31)29(27(34)35-23)22(26(32)33-2)18-13-8-7-9-14-18/h7-11,13-16,22H,3-6,12,17H2,1-2H3/b23-21- |
| InChIKey | ZNUVATRQHIQRIY-LNVKXUELSA-N |
| XLogP | 5.49 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|