C29H33N3O3S2 — CID 3813432
2-[3-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]-N-(2-phenylethyl)acetamide (PubChem CID 3813432) has the molecular formula C29H33N3O3S2 and a molecular weight of 535.74 g/mol. Its IUPAC name is 2-[3-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[3-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 3813432 |
| Molecular Formula | C29H33N3O3S2 |
| Molecular Weight | 535.74 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 2-[3-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]-N-(2-phenylethyl)acetamide |
| SMILES | CCCCCCCCN1C(=O)C(=C2C(=O)N(CC(=O)NCCc3ccccc3)c3ccccc32)SC1=S |
| InChI | InChI=1S/C29H33N3O3S2/c1-2-3-4-5-6-12-19-31-28(35)26(37-29(31)36)25-22-15-10-11-16-23(22)32(27(25)34)20-24(33)30-18-17-21-13-8-7-9-14-21/h7-11,13-16H,2-6,12,17-20H2,1H3,(H,30,33) |
| InChIKey | PQHXMTAOEMSKCC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.74 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|