C25H25N3O3S2 — CID 23917741
2-[(3E)-3-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]-N-(2-phenylethyl)acetamide (PubChem CID 23917741) has the molecular formula C25H25N3O3S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is 2-[(3E)-3-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[(3E)-3-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 23917741 |
| Molecular Formula | C25H25N3O3S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 2-[(3E)-3-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]-N-(2-phenylethyl)acetamide |
| SMILES | CCCCN1C(=O)/C(=C2\C(=O)N(CC(=O)NCCc3ccccc3)c3ccccc32)SC1=S |
| InChI | InChI=1S/C25H25N3O3S2/c1-2-3-15-27-24(31)22(33-25(27)32)21-18-11-7-8-12-19(18)28(23(21)30)16-20(29)26-14-13-17-9-5-4-6-10-17/h4-12H,2-3,13-16H2,1H3,(H,26,29)/b22-21+ |
| InChIKey | DRHQFSVYYDUKNG-QURGRASLSA-N |
| XLogP | 3.76 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|