C23H20ClN3O5S2 — CID 19200641
4-chloro-N-[(5E)-5-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 19200641) has the molecular formula C23H20ClN3O5S2 and a molecular weight of 518.02 g/mol. Its IUPAC name is 4-chloro-N-[(5E)-5-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[(5E)-5-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 19200641 |
| Molecular Formula | C23H20ClN3O5S2 |
| Molecular Weight | 518.02 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 4-chloro-N-[(5E)-5-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(NN1C(=O)/C(=C\c2ccc(OCC(=O)N3CCOCC3)cc2)SC1=S)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClN3O5S2/c24-17-5-3-16(4-6-17)21(29)25-27-22(30)19(34-23(27)33)13-15-1-7-18(8-2-15)32-14-20(28)26-9-11-31-12-10-26/h1-8,13H,9-12,14H2,(H,25,29)/b19-13+ |
| InChIKey | WHYOZPRVUOSCCN-CPNJWEJPSA-N |
| XLogP | 3.12 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.02 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|