C24H22ClN3O6S2 — CID 19200545
4-chloro-N-[(5E)-5-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 19200545) has the molecular formula C24H22ClN3O6S2 and a molecular weight of 548.04 g/mol. Its IUPAC name is 4-chloro-N-[(5E)-5-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[(5E)-5-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 19200545 |
| Molecular Formula | C24H22ClN3O6S2 |
| Molecular Weight | 548.04 g/mol |
| Exact Mass | 547.06 |
| IUPAC Name | 4-chloro-N-[(5E)-5-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | COc1cc(/C=C2/SC(=S)N(NC(=O)c3ccc(Cl)cc3)C2=O)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H22ClN3O6S2/c1-32-19-12-15(2-7-18(19)34-14-21(29)27-8-10-33-11-9-27)13-20-23(31)28(24(35)36-20)26-22(30)16-3-5-17(25)6-4-16/h2-7,12-13H,8-11,14H2,1H3,(H,26,30)/b20-13+ |
| InChIKey | ZTUSLGQIIJYCAU-DEDYPNTBSA-N |
| XLogP | 3.13 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.04 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|