C20H21BrO5 — CID 19205825
methyl 4-[2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetyl]oxybenzoate (PubChem CID 19205825) has the molecular formula C20H21BrO5 and a molecular weight of 421.29 g/mol. Its IUPAC name is methyl 4-[2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetyl]oxybenzoate.
| Compound Name | methyl 4-[2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetyl]oxybenzoate |
|---|---|
| PubChem CID | 19205825 |
| Molecular Formula | C20H21BrO5 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | methyl 4-[2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetyl]oxybenzoate |
| SMILES | COC(=O)c1ccc(OC(=O)COc2cc(C)c(Br)cc2C(C)C)cc1 |
| InChI | InChI=1S/C20H21BrO5/c1-12(2)16-10-17(21)13(3)9-18(16)25-11-19(22)26-15-7-5-14(6-8-15)20(23)24-4/h5-10,12H,11H2,1-4H3 |
| InChIKey | BREKCSHPOLUDPA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|