C28H29BrN2O5 — CID 6003484
[4-[(Z)-[[2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate (PubChem CID 6003484) has the molecular formula C28H29BrN2O5 and a molecular weight of 553.45 g/mol. Its IUPAC name is [4-[(Z)-[[2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate.
| Compound Name | [4-[(Z)-[[2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 6003484 |
| Molecular Formula | C28H29BrN2O5 |
| Molecular Weight | 553.45 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | [4-[(Z)-[[2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate |
| SMILES | COc1cc(/C=N\NC(=O)COc2cc(C)c(Br)cc2C(C)C)ccc1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H29BrN2O5/c1-17(2)22-14-23(29)19(4)12-25(22)35-16-27(32)31-30-15-20-8-11-24(26(13-20)34-5)36-28(33)21-9-6-18(3)7-10-21/h6-15,17H,16H2,1-5H3,(H,31,32)/b30-15- |
| InChIKey | BEMQQQJKBGZIAK-MNDYBZJGSA-N |
| XLogP | 5.95 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|