C22H22BrClN2O3S — CID 19206013
4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]butanamide (PubChem CID 19206013) has the molecular formula C22H22BrClN2O3S and a molecular weight of 509.85 g/mol. Its IUPAC name is 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 19206013 |
| Molecular Formula | C22H22BrClN2O3S |
| Molecular Weight | 509.85 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 4-(2-bromo-4-chloro-3,5-dimethylphenoxy)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]butanamide |
| SMILES | COc1ccc(-c2csc(NC(=O)CCCOc3cc(C)c(Cl)c(C)c3Br)n2)cc1 |
| InChI | InChI=1S/C22H22BrClN2O3S/c1-13-11-18(20(23)14(2)21(13)24)29-10-4-5-19(27)26-22-25-17(12-30-22)15-6-8-16(28-3)9-7-15/h6-9,11-12H,4-5,10H2,1-3H3,(H,25,26,27) |
| InChIKey | AZTWAMYJEFUYTH-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.85 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|