C18H23BrN2O2S — CID 19206346
4-(2-bromo-4-propan-2-ylphenoxy)-N-(4,5-dimethyl-1,3-thiazol-2-yl)butanamide (PubChem CID 19206346) has the molecular formula C18H23BrN2O2S and a molecular weight of 411.37 g/mol. Its IUPAC name is 4-(2-bromo-4-propan-2-ylphenoxy)-N-(4,5-dimethyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(2-bromo-4-propan-2-ylphenoxy)-N-(4,5-dimethyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 19206346 |
| Molecular Formula | C18H23BrN2O2S |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 4-(2-bromo-4-propan-2-ylphenoxy)-N-(4,5-dimethyl-1,3-thiazol-2-yl)butanamide |
| SMILES | Cc1nc(NC(=O)CCCOc2ccc(C(C)C)cc2Br)sc1C |
| InChI | InChI=1S/C18H23BrN2O2S/c1-11(2)14-7-8-16(15(19)10-14)23-9-5-6-17(22)21-18-20-12(3)13(4)24-18/h7-8,10-11H,5-6,9H2,1-4H3,(H,20,21,22) |
| InChIKey | XPPZJPRVSVZLOO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|