C19H21BrO3 — CID 19206375
phenyl 4-(2-bromo-4-propan-2-ylphenoxy)butanoate (PubChem CID 19206375) has the molecular formula C19H21BrO3 and a molecular weight of 377.28 g/mol. Its IUPAC name is phenyl 4-(2-bromo-4-propan-2-ylphenoxy)butanoate.
| Compound Name | phenyl 4-(2-bromo-4-propan-2-ylphenoxy)butanoate |
|---|---|
| PubChem CID | 19206375 |
| Molecular Formula | C19H21BrO3 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | phenyl 4-(2-bromo-4-propan-2-ylphenoxy)butanoate |
| SMILES | CC(C)c1ccc(OCCCC(=O)Oc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C19H21BrO3/c1-14(2)15-10-11-18(17(20)13-15)22-12-6-9-19(21)23-16-7-4-3-5-8-16/h3-5,7-8,10-11,13-14H,6,9,12H2,1-2H3 |
| InChIKey | DBMFDULDKAVTAJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|