C25H21NO8 — CID 19207227
[4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]-2-ethoxyphenyl] 6-methoxy-2-oxochromene-3-carboxylate (PubChem CID 19207227) has the molecular formula C25H21NO8 and a molecular weight of 463.44 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]-2-ethoxyphenyl] 6-methoxy-2-oxochromene-3-carboxylate.
| Compound Name | [4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]-2-ethoxyphenyl] 6-methoxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 19207227 |
| Molecular Formula | C25H21NO8 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | [4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]-2-ethoxyphenyl] 6-methoxy-2-oxochromene-3-carboxylate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(OC(=O)c2cc3cc(OC)ccc3oc2=O)c(OCC)c1 |
| InChI | InChI=1S/C25H21NO8/c1-4-31-22-11-15(10-17(14-26)23(27)32-5-2)6-8-21(22)34-25(29)19-13-16-12-18(30-3)7-9-20(16)33-24(19)28/h6-13H,4-5H2,1-3H3/b17-10+ |
| InChIKey | CISXGNPMSOOVDZ-LICLKQGHSA-N |
| XLogP | 3.89 |
| TPSA | 125.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|