C16H17IN2O — CID 19214751
2-(2-ethoxyphenyl)-5-methylimidazo[1,2-a]pyridine;hydroiodide (PubChem CID 19214751) has the molecular formula C16H17IN2O and a molecular weight of 380.23 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-5-methylimidazo[1,2-a]pyridine;hydroiodide.
| Compound Name | 2-(2-ethoxyphenyl)-5-methylimidazo[1,2-a]pyridine;hydroiodide |
|---|---|
| PubChem CID | 19214751 |
| Molecular Formula | C16H17IN2O |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 2-(2-ethoxyphenyl)-5-methylimidazo[1,2-a]pyridine;hydroiodide |
| SMILES | CCOc1ccccc1-c1cn2c(C)cccc2n1.I |
| InChI | InChI=1S/C16H16N2O.HI/c1-3-19-15-9-5-4-8-13(15)14-11-18-12(2)7-6-10-16(18)17-14;/h4-11H,3H2,1-2H3;1H |
| InChIKey | AELKLPISLVDGTK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|